C17H20N2O5S — CID 11958509
3-[(2,5-dimethylphenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 11958509) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 3-[(2,5-dimethylphenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-[(2,5-dimethylphenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11958509 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-[(2,5-dimethylphenyl)sulfanylmethyl]-5-(2-methoxyethylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | COCCNC(=O)c1onc(CSc2cc(C)ccc2C)c1C(=O)O |
| InChI | InChI=1S/C17H20N2O5S/c1-10-4-5-11(2)13(8-10)25-9-12-14(17(21)22)15(24-19-12)16(20)18-6-7-23-3/h4-5,8H,6-7,9H2,1-3H3,(H,18,20)(H,21,22) |
| InChIKey | HUGZHOVFXFVEQP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|