C19H13F6N3O4 — CID 11958537
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 11958537) has the molecular formula C19H13F6N3O4 and a molecular weight of 461.32 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 11958537 |
| Molecular Formula | C19H13F6N3O4 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-3-(3-nitrophenyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CC(c2cccc([N+](=O)[O-])c2)=NO1 |
| InChI | InChI=1S/C19H13F6N3O4/c20-18(21,22)12-4-10(5-13(7-12)19(23,24)25)9-26-17(29)16-8-15(27-32-16)11-2-1-3-14(6-11)28(30)31/h1-7,16H,8-9H2,(H,26,29) |
| InChIKey | YQVXIZKDSRAPOD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|