C15H22F2N2O — CID 119585666
N-(1-amino-4-methylpentan-2-yl)-3-(2,3-difluorophenyl)propanamide (PubChem CID 119585666) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-(2,3-difluorophenyl)propanamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-(2,3-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 119585666 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-(2,3-difluorophenyl)propanamide |
| SMILES | CC(C)CC(CN)NC(=O)CCc1cccc(F)c1F |
| InChI | InChI=1S/C15H22F2N2O/c1-10(2)8-12(9-18)19-14(20)7-6-11-4-3-5-13(16)15(11)17/h3-5,10,12H,6-9,18H2,1-2H3,(H,19,20) |
| InChIKey | LCHMKHCHBMUEAD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |