C19H20N4O2S2 — CID 11958608
N-[5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide (PubChem CID 11958608) has the molecular formula C19H20N4O2S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide.
| Compound Name | N-[5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 11958608 |
| Molecular Formula | C19H20N4O2S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | N-[5-[2-(3-methoxyanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)Nc1nc(C)c(-c2csc(Nc3cccc(OC)c3)n2)s1 |
| InChI | InChI=1S/C19H20N4O2S2/c1-4-5-9-16(24)23-19-20-12(2)17(27-19)15-11-26-18(22-15)21-13-7-6-8-14(10-13)25-3/h4,6-8,10-11H,1,5,9H2,2-3H3,(H,21,22)(H,20,23,24) |
| InChIKey | KMTYKFYBFTYTBT-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|