C18H17ClN4OS2 — CID 11958618
N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide (PubChem CID 11958618) has the molecular formula C18H17ClN4OS2 and a molecular weight of 404.95 g/mol. Its IUPAC name is N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide.
| Compound Name | N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide |
|---|---|
| PubChem CID | 11958618 |
| Molecular Formula | C18H17ClN4OS2 |
| Molecular Weight | 404.95 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | N-[5-[2-(4-chloroanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)Nc1nc(C)c(-c2csc(Nc3ccc(Cl)cc3)n2)s1 |
| InChI | InChI=1S/C18H17ClN4OS2/c1-3-4-5-15(24)23-18-20-11(2)16(26-18)14-10-25-17(22-14)21-13-8-6-12(19)7-9-13/h3,6-10H,1,4-5H2,2H3,(H,21,22)(H,20,23,24) |
| InChIKey | FFYNZXGFBYJWEA-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.95 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|