C21H25ClN4OS2 — CID 11958621
N-[5-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]heptanamide (PubChem CID 11958621) has the molecular formula C21H25ClN4OS2 and a molecular weight of 449.05 g/mol. Its IUPAC name is N-[5-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]heptanamide.
| Compound Name | N-[5-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]heptanamide |
|---|---|
| PubChem CID | 11958621 |
| Molecular Formula | C21H25ClN4OS2 |
| Molecular Weight | 449.05 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | N-[5-[2-(5-chloro-2-methylanilino)-1,3-thiazol-4-yl]-4-methyl-1,3-thiazol-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1nc(C)c(-c2csc(Nc3cc(Cl)ccc3C)n2)s1 |
| InChI | InChI=1S/C21H25ClN4OS2/c1-4-5-6-7-8-18(27)26-21-23-14(3)19(29-21)17-12-28-20(25-17)24-16-11-15(22)10-9-13(16)2/h9-12H,4-8H2,1-3H3,(H,24,25)(H,23,26,27) |
| InChIKey | SUJPMPMXQFHKGP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.05 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|