C17H18N2O4S — CID 11958666
3-[(3,5-dimethylphenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 11958666) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 3-[(3,5-dimethylphenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-[(3,5-dimethylphenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 11958666 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 3-[(3,5-dimethylphenyl)sulfanylmethyl]-5-(prop-2-enylcarbamoyl)-1,2-oxazole-4-carboxylic acid |
| SMILES | C=CCNC(=O)c1onc(CSc2cc(C)cc(C)c2)c1C(=O)O |
| InChI | InChI=1S/C17H18N2O4S/c1-4-5-18-16(20)15-14(17(21)22)13(19-23-15)9-24-12-7-10(2)6-11(3)8-12/h4,6-8H,1,5,9H2,2-3H3,(H,18,20)(H,21,22) |
| InChIKey | MVWIPZLDZGAODL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|