C15H24ClN3O4S — CID 119586687
N-(1-amino-4-methylpentan-2-yl)-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride (PubChem CID 119586687) has the molecular formula C15H24ClN3O4S and a molecular weight of 377.89 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119586687 |
| Molecular Formula | C15H24ClN3O4S |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-4-(2-amino-2-oxoethyl)sulfonylbenzamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1ccc(S(=O)(=O)CC(N)=O)cc1.Cl |
| InChI | InChI=1S/C15H23N3O4S.ClH/c1-10(2)7-12(8-16)18-15(20)11-3-5-13(6-4-11)23(21,22)9-14(17)19;/h3-6,10,12H,7-9,16H2,1-2H3,(H2,17,19)(H,18,20);1H |
| InChIKey | KGYZTSAAXKSFDN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |