C22H42ClNO3 — CID 11958717
(2-hexoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride (PubChem CID 11958717) has the molecular formula C22H42ClNO3 and a molecular weight of 404.04 g/mol. Its IUPAC name is (2-hexoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride.
| Compound Name | (2-hexoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride |
|---|---|
| PubChem CID | 11958717 |
| Molecular Formula | C22H42ClNO3 |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 403.29 |
| IUPAC Name | (2-hexoxy-2-oxoethyl)-dimethyl-[2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl]azanium chloride |
| SMILES | CCCCCCOC(=O)C[N+](C)(C)CCOC1CC2CCC1(C)C2(C)C.[Cl-] |
| InChI | InChI=1S/C22H42NO3.ClH/c1-7-8-9-10-14-26-20(24)17-23(5,6)13-15-25-19-16-18-11-12-22(19,4)21(18,2)3;/h18-19H,7-17H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | XZEHXLDEQSIZQK-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|