About dibenzofuran-3-amine;hydrochloride
dibenzofuran-3-amine;hydrochloride (PubChem CID 11958719) has the molecular formula C12H10ClNO
and a molecular weight of 219.67 g/mol. Its IUPAC name is dibenzofuran-3-amine;hydrochloride.
Molecular Properties
| Compound Name | dibenzofuran-3-amine;hydrochloride |
| PubChem CID | 11958719 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | dibenzofuran-3-amine;hydrochloride |
| SMILES | Cl.Nc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H9NO.ClH/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8;/h1-7H,13H2;1H |
| InChIKey | IVINWYJZLOTUFA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze dibenzofuran-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzofuran-3-amine;hydrochloride?
The IUPAC name of dibenzofuran-3-amine;hydrochloride (CID 11958719) is dibenzofuran-3-amine;hydrochloride.
What is the SMILES notation for dibenzofuran-3-amine;hydrochloride?
The canonical SMILES for dibenzofuran-3-amine;hydrochloride is Cl.Nc1ccc2c(c1)oc1ccccc12.
What is the InChIKey of dibenzofuran-3-amine;hydrochloride?
The InChIKey is IVINWYJZLOTUFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO.ClH/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8;/h1-7H,13H2;1H.
What are the key properties of dibenzofuran-3-amine;hydrochloride?
dibenzofuran-3-amine;hydrochloride has a molecular weight of 219.67 g/mol, XLogP of 3.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzofuran-3-amine;hydrochloride is sourced from PubChem (CID 11958719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).