C11H18ClN3O3S — CID 119587651
N-(1-amino-4-methylpentan-2-yl)-5-nitrothiophene-3-carboxamide;hydrochloride (PubChem CID 119587651) has the molecular formula C11H18ClN3O3S and a molecular weight of 307.80 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-5-nitrothiophene-3-carboxamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-5-nitrothiophene-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119587651 |
| Molecular Formula | C11H18ClN3O3S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-5-nitrothiophene-3-carboxamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)c1csc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C11H17N3O3S.ClH/c1-7(2)3-9(5-12)13-11(15)8-4-10(14(16)17)18-6-8;/h4,6-7,9H,3,5,12H2,1-2H3,(H,13,15);1H |
| InChIKey | YBWGENFFHKDVFD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|