C14H25Cl2N3O2 — CID 119587934
N-(1-amino-4-methylpentan-2-yl)-2-pyridin-3-yloxypropanamide;dihydrochloride (PubChem CID 119587934) has the molecular formula C14H25Cl2N3O2 and a molecular weight of 338.28 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-2-pyridin-3-yloxypropanamide;dihydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-2-pyridin-3-yloxypropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119587934 |
| Molecular Formula | C14H25Cl2N3O2 |
| Molecular Weight | 338.28 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-2-pyridin-3-yloxypropanamide;dihydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)C(C)Oc1cccnc1.Cl.Cl |
| InChI | InChI=1S/C14H23N3O2.2ClH/c1-10(2)7-12(8-15)17-14(18)11(3)19-13-5-4-6-16-9-13;;/h4-6,9-12H,7-8,15H2,1-3H3,(H,17,18);2*1H |
| InChIKey | IBBAXBUCIHJLIW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |