C31H27N7O9 — CID 11958807
(8S)-7-benzoyl-N-(1-carbamoylcyclopropyl)-3-[3-[(3,5-dinitrobenzoyl)amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide (PubChem CID 11958807) has the molecular formula C31H27N7O9 and a molecular weight of 641.60 g/mol. Its IUPAC name is (8S)-7-benzoyl-N-(1-carbamoylcyclopropyl)-3-[3-[(3,5-dinitrobenzoyl)amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide.
| Compound Name | (8S)-7-benzoyl-N-(1-carbamoylcyclopropyl)-3-[3-[(3,5-dinitrobenzoyl)amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
|---|---|
| PubChem CID | 11958807 |
| Molecular Formula | C31H27N7O9 |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | (8S)-7-benzoyl-N-(1-carbamoylcyclopropyl)-3-[3-[(3,5-dinitrobenzoyl)amino]phenyl]-1-oxa-2,7-diazaspiro[4.4]non-2-ene-8-carboxamide |
| SMILES | NC(=O)C1(NC(=O)[C@@H]2CC3(CC(c4cccc(NC(=O)c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5)c4)=NO3)CN2C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H27N7O9/c32-29(42)31(9-10-31)34-27(40)25-16-30(17-36(25)28(41)18-5-2-1-3-6-18)15-24(35-47-30)19-7-4-8-21(11-19)33-26(39)20-12-22(37(43)44)14-23(13-20)38(45)46/h1-8,11-14,25H,9-10,15-17H2,(H2,32,42)(H,33,39)(H,34,40)/t25-,30?/m0/s1 |
| InChIKey | RKJUOOABWJTTNE-SUHMBNCMSA-N |
| XLogP | 2.67 |
| TPSA | 229.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|