C16H26Cl2N2O2 — CID 119588775
N-(1-amino-4-methylpentan-2-yl)-4-(2-chlorophenoxy)butanamide;hydrochloride (PubChem CID 119588775) has the molecular formula C16H26Cl2N2O2 and a molecular weight of 349.30 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-4-(2-chlorophenoxy)butanamide;hydrochloride.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-4-(2-chlorophenoxy)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119588775 |
| Molecular Formula | C16H26Cl2N2O2 |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-4-(2-chlorophenoxy)butanamide;hydrochloride |
| SMILES | CC(C)CC(CN)NC(=O)CCCOc1ccccc1Cl.Cl |
| InChI | InChI=1S/C16H25ClN2O2.ClH/c1-12(2)10-13(11-18)19-16(20)8-5-9-21-15-7-4-3-6-14(15)17;/h3-4,6-7,12-13H,5,8-11,18H2,1-2H3,(H,19,20);1H |
| InChIKey | KJYYJYYOPYZYJV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|