About 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride
1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride (PubChem CID 11958907) has the molecular formula C23H39ClN2O2
and a molecular weight of 411.03 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride |
| PubChem CID | 11958907 |
| Molecular Formula | C23H39ClN2O2 |
| Molecular Weight | 411.03 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride |
| SMILES | CC1CC(OCC(O)CN2CCN(Cc3ccccc3)CC2)CC(C)(C)C1.Cl |
| InChI | InChI=1S/C23H38N2O2.ClH/c1-19-13-22(15-23(2,3)14-19)27-18-21(26)17-25-11-9-24(10-12-25)16-20-7-5-4-6-8-20;/h4-8,19,21-22,26H,9-18H2,1-3H3;1H |
| InChIKey | WOWNOIWGVRNZFD-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.03 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
The IUPAC name of 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride (CID 11958907) is 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride.
What is the SMILES notation for 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
The canonical SMILES for 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride is CC1CC(OCC(O)CN2CCN(Cc3ccccc3)CC2)CC(C)(C)C1.Cl.
What is the InChIKey of 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
The InChIKey is WOWNOIWGVRNZFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38N2O2.ClH/c1-19-13-22(15-23(2,3)14-19)27-18-21(26)17-25-11-9-24(10-12-25)16-20-7-5-4-6-8-20;/h4-8,19,21-22,26H,9-18H2,1-3H3;1H.
What are the key properties of 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride?
1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride has a molecular weight of 411.03 g/mol, XLogP of 3.82, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-benzylpiperazin-1-yl)-3-(3,3,5-trimethylcyclohexyl)oxypropan-2-ol;hydrochloride is sourced from PubChem (CID 11958907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).