About 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide
4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide (PubChem CID 11958912) has the molecular formula C18H17BrN4S
and a molecular weight of 401.33 g/mol. Its IUPAC name is 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide |
| PubChem CID | 11958912 |
| Molecular Formula | C18H17BrN4S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide |
| SMILES | Br.Cc1ccc(Nc2nc(-c3c(C)nc4ccccn34)cs2)cc1 |
| InChI | InChI=1S/C18H16N4S.BrH/c1-12-6-8-14(9-7-12)20-18-21-15(11-23-18)17-13(2)19-16-5-3-4-10-22(16)17;/h3-11H,1-2H3,(H,20,21);1H |
| InChIKey | PJIXSLVITKYKTC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide?
The IUPAC name of 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide (CID 11958912) is 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide.
What is the SMILES notation for 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide?
The canonical SMILES for 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide is Br.Cc1ccc(Nc2nc(-c3c(C)nc4ccccn34)cs2)cc1.
What is the InChIKey of 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide?
The InChIKey is PJIXSLVITKYKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N4S.BrH/c1-12-6-8-14(9-7-12)20-18-21-15(11-23-18)17-13(2)19-16-5-3-4-10-22(16)17;/h3-11H,1-2H3,(H,20,21);1H.
What are the key properties of 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide?
4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide has a molecular weight of 401.33 g/mol, XLogP of 5.40, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrobromide is sourced from PubChem (CID 11958912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).