C11H14N2 — CID 11958957
1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-5-amine (PubChem CID 11958957) has the molecular formula C11H14N2 and a molecular weight of 174.25 g/mol. Its IUPAC name is 1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-5-amine.
| Compound Name | 1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-5-amine |
|---|---|
| PubChem CID | 11958957 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-5-amine |
| SMILES | Nc1ccc2c(c1)C1CCN2CC1 |
| InChI | InChI=1S/C11H14N2/c12-9-1-2-11-10(7-9)8-3-5-13(11)6-4-8/h1-2,7-8H,3-6,12H2 |
| InChIKey | ZCABPFSEWFEWQP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|