About 3-bromo-9H-fluorene
3-bromo-9H-fluorene (PubChem CID 11959045) has the molecular formula C13H9Br
and a molecular weight of 245.12 g/mol. Its IUPAC name is 3-bromo-9H-fluorene.
Molecular Properties
| Compound Name | 3-bromo-9H-fluorene |
| PubChem CID | 11959045 |
| Molecular Formula | C13H9Br |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 243.99 |
| IUPAC Name | 3-bromo-9H-fluorene |
| SMILES | Brc1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C13H9Br/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8H,7H2 |
| InChIKey | NJJDBOFDNCZGSP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-bromo-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-9H-fluorene?
The IUPAC name of 3-bromo-9H-fluorene (CID 11959045) is 3-bromo-9H-fluorene.
What is the SMILES notation for 3-bromo-9H-fluorene?
The canonical SMILES for 3-bromo-9H-fluorene is Brc1ccc2c(c1)-c1ccccc1C2.
What is the InChIKey of 3-bromo-9H-fluorene?
The InChIKey is NJJDBOFDNCZGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9Br/c14-11-6-5-10-7-9-3-1-2-4-12(9)13(10)8-11/h1-6,8H,7H2.
What are the key properties of 3-bromo-9H-fluorene?
3-bromo-9H-fluorene has a molecular weight of 245.12 g/mol, XLogP of 4.02, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-9H-fluorene is sourced from PubChem (CID 11959045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).