C18H25F3N2O — CID 119590512
N-(2-amino-1-cyclohexylethyl)-4,4,4-trifluoro-3-phenylbutanamide (PubChem CID 119590512) has the molecular formula C18H25F3N2O and a molecular weight of 342.40 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4,4,4-trifluoro-3-phenylbutanamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4,4,4-trifluoro-3-phenylbutanamide |
|---|---|
| PubChem CID | 119590512 |
| Molecular Formula | C18H25F3N2O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4,4,4-trifluoro-3-phenylbutanamide |
| SMILES | NCC(NC(=O)CC(c1ccccc1)C(F)(F)F)C1CCCCC1 |
| InChI | InChI=1S/C18H25F3N2O/c19-18(20,21)15(13-7-3-1-4-8-13)11-17(24)23-16(12-22)14-9-5-2-6-10-14/h1,3-4,7-8,14-16H,2,5-6,9-12,22H2,(H,23,24) |
| InChIKey | ZEKXHTHPYPGDGU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |