C17H24N4O — CID 119590893
N-(2-amino-1-cyclohexylethyl)-2-(2H-indazol-3-yl)acetamide (PubChem CID 119590893) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(2H-indazol-3-yl)acetamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(2H-indazol-3-yl)acetamide |
|---|---|
| PubChem CID | 119590893 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(2H-indazol-3-yl)acetamide |
| SMILES | NCC(NC(=O)Cc1[nH]nc2ccccc12)C1CCCCC1 |
| InChI | InChI=1S/C17H24N4O/c18-11-16(12-6-2-1-3-7-12)19-17(22)10-15-13-8-4-5-9-14(13)20-21-15/h4-5,8-9,12,16H,1-3,6-7,10-11,18H2,(H,19,22)(H,20,21) |
| InChIKey | YNQOFNKVKPUZBA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |