C21H30N4O2 — CID 119591581
N-(2-amino-1-cyclohexylethyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide (PubChem CID 119591581) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide |
|---|---|
| PubChem CID | 119591581 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-3-(2-methylpropyl)-4-oxophthalazine-1-carboxamide |
| SMILES | CC(C)Cn1nc(C(=O)NC(CN)C2CCCCC2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H30N4O2/c1-14(2)13-25-21(27)17-11-7-6-10-16(17)19(24-25)20(26)23-18(12-22)15-8-4-3-5-9-15/h6-7,10-11,14-15,18H,3-5,8-9,12-13,22H2,1-2H3,(H,23,26) |
| InChIKey | VUPGFDVIRXOLSW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |