C23H30N4O2 — CID 119591792
N-(2-amino-1-cyclohexylethyl)-4-methyl-3-(phenylcarbamoylamino)benzamide (PubChem CID 119591792) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-4-methyl-3-(phenylcarbamoylamino)benzamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-4-methyl-3-(phenylcarbamoylamino)benzamide |
|---|---|
| PubChem CID | 119591792 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-4-methyl-3-(phenylcarbamoylamino)benzamide |
| SMILES | Cc1ccc(C(=O)NC(CN)C2CCCCC2)cc1NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H30N4O2/c1-16-12-13-18(22(28)26-21(15-24)17-8-4-2-5-9-17)14-20(16)27-23(29)25-19-10-6-3-7-11-19/h3,6-7,10-14,17,21H,2,4-5,8-9,15,24H2,1H3,(H,26,28)(H2,25,27,29) |
| InChIKey | CCCOMLYODURVBE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |