C16H29N3O3S — CID 119591812
N-(2-amino-1-cyclohexylethyl)-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide (PubChem CID 119591812) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 119591812 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
| SMILES | NCC(NC(=O)CSCC(=O)N1CCOCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H29N3O3S/c17-10-14(13-4-2-1-3-5-13)18-15(20)11-23-12-16(21)19-6-8-22-9-7-19/h13-14H,1-12,17H2,(H,18,20) |
| InChIKey | FLTKWSYXNHHCHY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |