C15H27ClN4O3 — CID 119592217
N-(2-amino-1-cyclohexylethyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide;hydrochloride (PubChem CID 119592217) has the molecular formula C15H27ClN4O3 and a molecular weight of 346.86 g/mol. Its IUPAC name is N-(2-amino-1-cyclohexylethyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclohexylethyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119592217 |
| Molecular Formula | C15H27ClN4O3 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-(2-amino-1-cyclohexylethyl)-2-(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)acetamide;hydrochloride |
| SMILES | CC1(C)C(=O)NC(=O)N1CC(=O)NC(CN)C1CCCCC1.Cl |
| InChI | InChI=1S/C15H26N4O3.ClH/c1-15(2)13(21)18-14(22)19(15)9-12(20)17-11(8-16)10-6-4-3-5-7-10;/h10-11H,3-9,16H2,1-2H3,(H,17,20)(H,18,21,22);1H |
| InChIKey | XZKJAYQCANOOMX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|