C32H42O5 — CID 11959402
propan-2-yl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate (PubChem CID 11959402) has the molecular formula C32H42O5 and a molecular weight of 506.68 g/mol. Its IUPAC name is propan-2-yl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11959402 |
| Molecular Formula | C32H42O5 |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.30 |
| IUPAC Name | propan-2-yl (Z)-7-[(1R,4S,5R)-4-hydroxy-5-[(E)-3-hydroxy-5-naphthalen-2-ylpent-1-enyl]-3,3-dimethyl-2-oxocyclopentyl]hept-5-enoate |
| SMILES | CC(C)OC(=O)CCC/C=C\C[C@H]1C(=O)C(C)(C)[C@@H](O)[C@@H]1/C=C/C(O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C32H42O5/c1-22(2)37-29(34)14-8-6-5-7-13-27-28(31(36)32(3,4)30(27)35)20-19-26(33)18-16-23-15-17-24-11-9-10-12-25(24)21-23/h5,7,9-12,15,17,19-22,26-28,31,33,36H,6,8,13-14,16,18H2,1-4H3/b7-5-,20-19+/t26?,27-,28-,31+/m1/s1 |
| InChIKey | SUGJOLDGOKYEQF-JYBIWFEPSA-N |
| XLogP | 5.96 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|