C12H22N2OS2 — CID 119596392
[3-(1-aminoethyl)piperidin-1-yl]-(1,4-dithian-2-yl)methanone (PubChem CID 119596392) has the molecular formula C12H22N2OS2 and a molecular weight of 274.46 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-(1,4-dithian-2-yl)methanone.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-(1,4-dithian-2-yl)methanone |
|---|---|
| PubChem CID | 119596392 |
| Molecular Formula | C12H22N2OS2 |
| Molecular Weight | 274.46 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-(1,4-dithian-2-yl)methanone |
| SMILES | CC(N)C1CCCN(C(=O)C2CSCCS2)C1 |
| InChI | InChI=1S/C12H22N2OS2/c1-9(13)10-3-2-4-14(7-10)12(15)11-8-16-5-6-17-11/h9-11H,2-8,13H2,1H3 |
| InChIKey | ARNCVRHZFUNITG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |