C14H18ClF3N2O — CID 119596663
[3-(1-aminoethyl)piperidin-1-yl]-(3,4,5-trifluorophenyl)methanone;hydrochloride (PubChem CID 119596663) has the molecular formula C14H18ClF3N2O and a molecular weight of 322.76 g/mol. Its IUPAC name is [3-(1-aminoethyl)piperidin-1-yl]-(3,4,5-trifluorophenyl)methanone;hydrochloride.
| Compound Name | [3-(1-aminoethyl)piperidin-1-yl]-(3,4,5-trifluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119596663 |
| Molecular Formula | C14H18ClF3N2O |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | [3-(1-aminoethyl)piperidin-1-yl]-(3,4,5-trifluorophenyl)methanone;hydrochloride |
| SMILES | CC(N)C1CCCN(C(=O)c2cc(F)c(F)c(F)c2)C1.Cl |
| InChI | InChI=1S/C14H17F3N2O.ClH/c1-8(18)9-3-2-4-19(7-9)14(20)10-5-11(15)13(17)12(16)6-10;/h5-6,8-9H,2-4,7,18H2,1H3;1H |
| InChIKey | LPOMJIRISACVOA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|