C18H28ClN3O2 — CID 119596828
3-[3-(1-aminoethyl)piperidine-1-carbonyl]-N-ethyl-N-methylbenzamide;hydrochloride (PubChem CID 119596828) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is 3-[3-(1-aminoethyl)piperidine-1-carbonyl]-N-ethyl-N-methylbenzamide;hydrochloride.
| Compound Name | 3-[3-(1-aminoethyl)piperidine-1-carbonyl]-N-ethyl-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119596828 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | 3-[3-(1-aminoethyl)piperidine-1-carbonyl]-N-ethyl-N-methylbenzamide;hydrochloride |
| SMILES | CCN(C)C(=O)c1cccc(C(=O)N2CCCC(C(C)N)C2)c1.Cl |
| InChI | InChI=1S/C18H27N3O2.ClH/c1-4-20(3)17(22)14-7-5-8-15(11-14)18(23)21-10-6-9-16(12-21)13(2)19;/h5,7-8,11,13,16H,4,6,9-10,12,19H2,1-3H3;1H |
| InChIKey | ZNSORNOVGRDBMB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |