C18H29Cl2N5O3 — CID 119597741
N-(1-amino-2,4-dimethylpentan-2-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride (PubChem CID 119597741) has the molecular formula C18H29Cl2N5O3 and a molecular weight of 434.37 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119597741 |
| Molecular Formula | C18H29Cl2N5O3 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-1,3,5-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide;dihydrochloride |
| SMILES | Cc1cc(C(=O)NC(C)(CN)CC(C)C)nc2c1c(=O)n(C)c(=O)n2C.Cl.Cl |
| InChI | InChI=1S/C18H27N5O3.2ClH/c1-10(2)8-18(4,9-19)21-15(24)12-7-11(3)13-14(20-12)22(5)17(26)23(6)16(13)25;;/h7,10H,8-9,19H2,1-6H3,(H,21,24);2*1H |
| InChIKey | HDEPFFBQNZQDDK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |