About 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid
4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid (PubChem CID 11959811) has the molecular formula C27H30FNO3S
and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid.
Molecular Properties
| Compound Name | 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid |
| PubChem CID | 11959811 |
| Molecular Formula | C27H30FNO3S |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid |
| SMILES | Cc1cc(COC(CCC2CCCCC2)c2nccs2)ccc1-c1ccc(C(=O)O)c(F)c1 |
| InChI | InChI=1S/C27H30FNO3S/c1-18-15-20(7-10-22(18)21-9-11-23(27(30)31)24(28)16-21)17-32-25(26-29-13-14-33-26)12-8-19-5-3-2-4-6-19/h7,9-11,13-16,19,25H,2-6,8,12,17H2,1H3,(H,30,31) |
| InChIKey | AADBAZUCGNXKJR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid?
The IUPAC name of 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid (CID 11959811) is 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid.
What is the SMILES notation for 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid?
The canonical SMILES for 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid is Cc1cc(COC(CCC2CCCCC2)c2nccs2)ccc1-c1ccc(C(=O)O)c(F)c1.
What is the InChIKey of 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid?
The InChIKey is AADBAZUCGNXKJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30FNO3S/c1-18-15-20(7-10-22(18)21-9-11-23(27(30)31)24(28)16-21)17-32-25(26-29-13-14-33-26)12-8-19-5-3-2-4-6-19/h7,9-11,13-16,19,25H,2-6,8,12,17H2,1H3,(H,30,31).
What are the key properties of 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid?
4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid has a molecular weight of 467.61 g/mol, XLogP of 7.57, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[3-cyclohexyl-1-(1,3-thiazol-2-yl)propoxy]methyl]-2-methylphenyl]-2-fluorobenzoic acid is sourced from PubChem (CID 11959811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).