C18H29FN2O3 — CID 119598512
N-(1-amino-2,4-dimethylpentan-2-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide (PubChem CID 119598512) has the molecular formula C18H29FN2O3 and a molecular weight of 340.44 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide |
|---|---|
| PubChem CID | 119598512 |
| Molecular Formula | C18H29FN2O3 |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4-fluoro-3-(2-methoxyethoxymethyl)benzamide |
| SMILES | COCCOCc1cc(C(=O)NC(C)(CN)CC(C)C)ccc1F |
| InChI | InChI=1S/C18H29FN2O3/c1-13(2)10-18(3,12-20)21-17(22)14-5-6-16(19)15(9-14)11-24-8-7-23-4/h5-6,9,13H,7-8,10-12,20H2,1-4H3,(H,21,22) |
| InChIKey | LVOJUBSBLKXZLP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|