C18H29N3O4 — CID 119599234
N-(1-amino-2,4-dimethylpentan-2-yl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide (PubChem CID 119599234) has the molecular formula C18H29N3O4 and a molecular weight of 351.45 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 119599234 |
| Molecular Formula | C18H29N3O4 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)propanamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)CCN1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C18H29N3O4/c1-10(2)8-18(3,9-19)20-13(22)6-7-21-16(23)14-11-4-5-12(25-11)15(14)17(21)24/h10-12,14-15H,4-9,19H2,1-3H3,(H,20,22) |
| InChIKey | AIYHXTPTBKSRIU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|