C15H27ClN4O — CID 119600722
N-[2-(aminomethyl)cyclopentyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide;hydrochloride (PubChem CID 119600722) has the molecular formula C15H27ClN4O and a molecular weight of 314.86 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119600722 |
| Molecular Formula | C15H27ClN4O |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-1-tert-butyl-5-methylpyrazole-4-carboxamide;hydrochloride |
| SMILES | Cc1c(C(=O)NC2CCCC2CN)cnn1C(C)(C)C.Cl |
| InChI | InChI=1S/C15H26N4O.ClH/c1-10-12(9-17-19(10)15(2,3)4)14(20)18-13-7-5-6-11(13)8-16;/h9,11,13H,5-8,16H2,1-4H3,(H,18,20);1H |
| InChIKey | WASYWPCVFPIASD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |