About 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide
2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide (PubChem CID 11960092) has the molecular formula C20H19F4N3O
and a molecular weight of 393.38 g/mol. Its IUPAC name is 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
| PubChem CID | 11960092 |
| Molecular Formula | C20H19F4N3O |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide |
| SMILES | CC(C(=O)N(C)C)N(Cc1ccccc1F)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F4N3O/c1-13(19(28)26(2)3)27(12-15-6-4-5-7-18(15)21)16-9-8-14(11-25)17(10-16)20(22,23)24/h4-10,13H,12H2,1-3H3 |
| InChIKey | MALNKDJUDRIVJP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide?
The IUPAC name of 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide (CID 11960092) is 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide.
What is the SMILES notation for 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide?
The canonical SMILES for 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide is CC(C(=O)N(C)C)N(Cc1ccccc1F)c1ccc(C#N)c(C(F)(F)F)c1.
What is the InChIKey of 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide?
The InChIKey is MALNKDJUDRIVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F4N3O/c1-13(19(28)26(2)3)27(12-15-6-4-5-7-18(15)21)16-9-8-14(11-25)17(10-16)20(22,23)24/h4-10,13H,12H2,1-3H3.
What are the key properties of 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide?
2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide has a molecular weight of 393.38 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-cyano-N-[(2-fluorophenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylpropanamide is sourced from PubChem (CID 11960092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).