About 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide
2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide (PubChem CID 11960097) has the molecular formula C22H24F3N3O
and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide |
| PubChem CID | 11960097 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide |
| SMILES | CCC(C(=O)N(C)C)N(Cc1ccccc1C)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H24F3N3O/c1-5-20(21(29)27(3)4)28(14-17-9-7-6-8-15(17)2)18-11-10-16(13-26)19(12-18)22(23,24)25/h6-12,20H,5,14H2,1-4H3 |
| InChIKey | KBEXRAYNSZVIQA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide?
The IUPAC name of 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide (CID 11960097) is 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide.
What is the SMILES notation for 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide?
The canonical SMILES for 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide is CCC(C(=O)N(C)C)N(Cc1ccccc1C)c1ccc(C#N)c(C(F)(F)F)c1.
What is the InChIKey of 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide?
The InChIKey is KBEXRAYNSZVIQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24F3N3O/c1-5-20(21(29)27(3)4)28(14-17-9-7-6-8-15(17)2)18-11-10-16(13-26)19(12-18)22(23,24)25/h6-12,20H,5,14H2,1-4H3.
What are the key properties of 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide?
2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide has a molecular weight of 403.45 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-cyano-N-[(2-methylphenyl)methyl]-3-(trifluoromethyl)anilino]-N,N-dimethylbutanamide is sourced from PubChem (CID 11960097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).