C17H26ClFN2O — CID 119600994
N-[2-(aminomethyl)cyclopentyl]-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride (PubChem CID 119600994) has the molecular formula C17H26ClFN2O and a molecular weight of 328.86 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119600994 |
| Molecular Formula | C17H26ClFN2O |
| Molecular Weight | 328.86 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-4-(3-fluorophenyl)-2-methylbutanamide;hydrochloride |
| SMILES | CC(CCc1cccc(F)c1)C(=O)NC1CCCC1CN.Cl |
| InChI | InChI=1S/C17H25FN2O.ClH/c1-12(8-9-13-4-2-6-15(18)10-13)17(21)20-16-7-3-5-14(16)11-19;/h2,4,6,10,12,14,16H,3,5,7-9,11,19H2,1H3,(H,20,21);1H |
| InChIKey | YMXKDGNZDSENCL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.86 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |