C13H18ClFN4O3 — CID 119602993
2-amino-N-[2-(aminomethyl)cyclopentyl]-5-fluoro-3-nitrobenzamide;hydrochloride (PubChem CID 119602993) has the molecular formula C13H18ClFN4O3 and a molecular weight of 332.76 g/mol. Its IUPAC name is 2-amino-N-[2-(aminomethyl)cyclopentyl]-5-fluoro-3-nitrobenzamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(aminomethyl)cyclopentyl]-5-fluoro-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119602993 |
| Molecular Formula | C13H18ClFN4O3 |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-amino-N-[2-(aminomethyl)cyclopentyl]-5-fluoro-3-nitrobenzamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1cc(F)cc([N+](=O)[O-])c1N |
| InChI | InChI=1S/C13H17FN4O3.ClH/c14-8-4-9(12(16)11(5-8)18(20)21)13(19)17-10-3-1-2-7(10)6-15;/h4-5,7,10H,1-3,6,15-16H2,(H,17,19);1H |
| InChIKey | YHTKDTQIVUNUCC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|