C14H19ClN4O2 — CID 119603692
N-[2-(aminomethyl)cyclopentyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride (PubChem CID 119603692) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119603692 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C14H18N4O2.ClH/c15-8-9-3-1-4-10(9)16-14(19)12-7-11(17-18-12)13-5-2-6-20-13;/h2,5-7,9-10H,1,3-4,8,15H2,(H,16,19)(H,17,18);1H |
| InChIKey | XXJFYZZVQIZHRW-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |