About (2-amino-2-oxoethyl) N-oct-7-enylcarbamate
(2-amino-2-oxoethyl) N-oct-7-enylcarbamate (PubChem CID 11960464) has the molecular formula C11H20N2O3
and a molecular weight of 228.29 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) N-oct-7-enylcarbamate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) N-oct-7-enylcarbamate |
| PubChem CID | 11960464 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (2-amino-2-oxoethyl) N-oct-7-enylcarbamate |
| SMILES | C=CCCCCCCNC(=O)OCC(N)=O |
| InChI | InChI=1S/C11H20N2O3/c1-2-3-4-5-6-7-8-13-11(15)16-9-10(12)14/h2H,1,3-9H2,(H2,12,14)(H,13,15) |
| InChIKey | DLDOQIUSBOEGIQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-2-oxoethyl) N-oct-7-enylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) N-oct-7-enylcarbamate?
The IUPAC name of (2-amino-2-oxoethyl) N-oct-7-enylcarbamate (CID 11960464) is (2-amino-2-oxoethyl) N-oct-7-enylcarbamate.
What is the SMILES notation for (2-amino-2-oxoethyl) N-oct-7-enylcarbamate?
The canonical SMILES for (2-amino-2-oxoethyl) N-oct-7-enylcarbamate is C=CCCCCCCNC(=O)OCC(N)=O.
What is the InChIKey of (2-amino-2-oxoethyl) N-oct-7-enylcarbamate?
The InChIKey is DLDOQIUSBOEGIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3/c1-2-3-4-5-6-7-8-13-11(15)16-9-10(12)14/h2H,1,3-9H2,(H2,12,14)(H,13,15).
What are the key properties of (2-amino-2-oxoethyl) N-oct-7-enylcarbamate?
(2-amino-2-oxoethyl) N-oct-7-enylcarbamate has a molecular weight of 228.29 g/mol, XLogP of 1.33, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) N-oct-7-enylcarbamate is sourced from PubChem (CID 11960464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).