About N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride
N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride (PubChem CID 119607556) has the molecular formula C18H24ClN3O2
and a molecular weight of 349.86 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride |
| PubChem CID | 119607556 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)c1ccc(-c2ccccc2)[nH]c1=O.Cl |
| InChI | InChI=1S/C18H23N3O2.ClH/c1-12(2)18(3,11-19)21-17(23)14-9-10-15(20-16(14)22)13-7-5-4-6-8-13;/h4-10,12H,11,19H2,1-3H3,(H,20,22)(H,21,23);1H |
| InChIKey | YSCIIWCPFSZVFF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride?
The IUPAC name of N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride (CID 119607556) is N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride.
What is the SMILES notation for N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride?
The canonical SMILES for N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride is CC(C)C(C)(CN)NC(=O)c1ccc(-c2ccccc2)[nH]c1=O.Cl.
What is the InChIKey of N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride?
The InChIKey is YSCIIWCPFSZVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O2.ClH/c1-12(2)18(3,11-19)21-17(23)14-9-10-15(20-16(14)22)13-7-5-4-6-8-13;/h4-10,12H,11,19H2,1-3H3,(H,20,22)(H,21,23);1H.
What are the key properties of N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride?
N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride has a molecular weight of 349.86 g/mol, XLogP of 2.57, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-amino-2,3-dimethylbutan-2-yl)-2-oxo-6-phenyl-1H-pyridine-3-carboxamide;hydrochloride is sourced from PubChem (CID 119607556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).