C16H25N3O4 — CID 119608591
N-(1-amino-2,3-dimethylbutan-2-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide (PubChem CID 119608591) has the molecular formula C16H25N3O4 and a molecular weight of 323.39 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 119608591 |
| Molecular Formula | C16H25N3O4 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-2-yl)acetamide |
| SMILES | CC(C)C(C)(CN)NC(=O)CN1C(=O)C2C3CCC(O3)C2C1=O |
| InChI | InChI=1S/C16H25N3O4/c1-8(2)16(3,7-17)18-11(20)6-19-14(21)12-9-4-5-10(23-9)13(12)15(19)22/h8-10,12-13H,4-7,17H2,1-3H3,(H,18,20) |
| InChIKey | WIRJKNORNABCKA-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|