C13H22ClN5O3 — CID 119609982
N-[2-(aminomethyl)cyclohexyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride (PubChem CID 119609982) has the molecular formula C13H22ClN5O3 and a molecular weight of 331.80 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119609982 |
| Molecular Formula | C13H22ClN5O3 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-1,3-dimethyl-4-nitropyrazole-5-carboxamide;hydrochloride |
| SMILES | Cc1nn(C)c(C(=O)NC2CCCCC2CN)c1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C13H21N5O3.ClH/c1-8-11(18(20)21)12(17(2)16-8)13(19)15-10-6-4-3-5-9(10)7-14;/h9-10H,3-7,14H2,1-2H3,(H,15,19);1H |
| InChIKey | YXFOPHIMOJBHJK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|