C17H27ClN2O3 — CID 119610949
N-[2-(aminomethyl)cyclohexyl]-2-(4-ethoxyphenoxy)acetamide;hydrochloride (PubChem CID 119610949) has the molecular formula C17H27ClN2O3 and a molecular weight of 342.87 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(4-ethoxyphenoxy)acetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(4-ethoxyphenoxy)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119610949 |
| Molecular Formula | C17H27ClN2O3 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(4-ethoxyphenoxy)acetamide;hydrochloride |
| SMILES | CCOc1ccc(OCC(=O)NC2CCCCC2CN)cc1.Cl |
| InChI | InChI=1S/C17H26N2O3.ClH/c1-2-21-14-7-9-15(10-8-14)22-12-17(20)19-16-6-4-3-5-13(16)11-18;/h7-10,13,16H,2-6,11-12,18H2,1H3,(H,19,20);1H |
| InChIKey | NKESSXNMJLOABR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |