C16H25ClN2O2S — CID 119612327
N-[2-(aminomethyl)cyclohexyl]-2-(4-methoxyphenyl)sulfanylacetamide;hydrochloride (PubChem CID 119612327) has the molecular formula C16H25ClN2O2S and a molecular weight of 344.91 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-2-(4-methoxyphenyl)sulfanylacetamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-2-(4-methoxyphenyl)sulfanylacetamide;hydrochloride |
|---|---|
| PubChem CID | 119612327 |
| Molecular Formula | C16H25ClN2O2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-2-(4-methoxyphenyl)sulfanylacetamide;hydrochloride |
| SMILES | COc1ccc(SCC(=O)NC2CCCCC2CN)cc1.Cl |
| InChI | InChI=1S/C16H24N2O2S.ClH/c1-20-13-6-8-14(9-7-13)21-11-16(19)18-15-5-3-2-4-12(15)10-17;/h6-9,12,15H,2-5,10-11,17H2,1H3,(H,18,19);1H |
| InChIKey | WOIOOUMILGAMEU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |