C18H35N3O2 — CID 119612503
N-[2-(aminomethyl)cyclohexyl]-N',N'-dipropylpentanediamide (PubChem CID 119612503) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclohexyl]-N',N'-dipropylpentanediamide.
| Compound Name | N-[2-(aminomethyl)cyclohexyl]-N',N'-dipropylpentanediamide |
|---|---|
| PubChem CID | 119612503 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | N-[2-(aminomethyl)cyclohexyl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)NC1CCCCC1CN |
| InChI | InChI=1S/C18H35N3O2/c1-3-12-21(13-4-2)18(23)11-7-10-17(22)20-16-9-6-5-8-15(16)14-19/h15-16H,3-14,19H2,1-2H3,(H,20,22) |
| InChIKey | YXKZOAAHUSKCIQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |