C24H39NO10 — CID 11961316
[(2R,3S,4R,5S)-5-acetamido-3,4,6-tri(butanoyloxy)oxan-2-yl]methyl butanoate (PubChem CID 11961316) has the molecular formula C24H39NO10 and a molecular weight of 501.57 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-5-acetamido-3,4,6-tri(butanoyloxy)oxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3S,4R,5S)-5-acetamido-3,4,6-tri(butanoyloxy)oxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 11961316 |
| Molecular Formula | C24H39NO10 |
| Molecular Weight | 501.57 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | [(2R,3S,4R,5S)-5-acetamido-3,4,6-tri(butanoyloxy)oxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1OC(OC(=O)CCC)[C@@H](NC(C)=O)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C24H39NO10/c1-6-10-17(27)31-14-16-22(33-18(28)11-7-2)23(34-19(29)12-8-3)21(25-15(5)26)24(32-16)35-20(30)13-9-4/h16,21-24H,6-14H2,1-5H3,(H,25,26)/t16-,21+,22-,23-,24?/m1/s1 |
| InChIKey | WUQBGYXGTNZCPW-PMPXDBTPSA-N |
| XLogP | 2.33 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|