About 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole
3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole (PubChem CID 11961329) has the molecular formula C17H21NO2S
and a molecular weight of 303.43 g/mol. Its IUPAC name is 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole |
| PubChem CID | 11961329 |
| Molecular Formula | C17H21NO2S |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole |
| SMILES | CC1=C2CN(S(=O)(=O)c3ccc(C)cc3)CC2(C)CC=C1 |
| InChI | InChI=1S/C17H21NO2S/c1-13-6-8-15(9-7-13)21(19,20)18-11-16-14(2)5-4-10-17(16,3)12-18/h4-9H,10-12H2,1-3H3 |
| InChIKey | AIKVXEZRFPKUKQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole?
The IUPAC name of 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole (CID 11961329) is 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole.
What is the SMILES notation for 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole?
The canonical SMILES for 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole is CC1=C2CN(S(=O)(=O)c3ccc(C)cc3)CC2(C)CC=C1.
What is the InChIKey of 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole?
The InChIKey is AIKVXEZRFPKUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO2S/c1-13-6-8-15(9-7-13)21(19,20)18-11-16-14(2)5-4-10-17(16,3)12-18/h4-9H,10-12H2,1-3H3.
What are the key properties of 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole?
3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole has a molecular weight of 303.43 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,7-dimethyl-2-(4-methylphenyl)sulfonyl-3,4-dihydro-1H-isoindole is sourced from PubChem (CID 11961329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).