C20H38O4Si — CID 11961345
[(2S,3S)-3-[(E)-6-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-3-methylhex-3-enyl]oxiran-2-yl]methanol (PubChem CID 11961345) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is [(2S,3S)-3-[(E)-6-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-3-methylhex-3-enyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(E)-6-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-3-methylhex-3-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11961345 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | [(2S,3S)-3-[(E)-6-[(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methyloxiran-2-yl]-3-methylhex-3-enyl]oxiran-2-yl]methanol |
| SMILES | C/C(=C\CC[C@@]1(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)CC[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C20H38O4Si/c1-15(10-11-16-17(13-21)23-16)9-8-12-20(5)18(24-20)14-22-25(6,7)19(2,3)4/h9,16-18,21H,8,10-14H2,1-7H3/b15-9+/t16-,17-,18-,20+/m0/s1 |
| InChIKey | UUKBBHUINOUNLO-CBDDKAGISA-N |
| XLogP | 4.43 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|