About 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine
4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine (PubChem CID 11961374) has the molecular formula C23H14F2N4
and a molecular weight of 384.39 g/mol. Its IUPAC name is 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine |
| PubChem CID | 11961374 |
| Molecular Formula | C23H14F2N4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine |
| SMILES | Fc1ccc(-c2nc3[nH]ncc3c(-c3ccc(F)cc3)c2-c2ccncc2)cc1 |
| InChI | InChI=1S/C23H14F2N4/c24-17-5-1-14(2-6-17)20-19-13-27-29-23(19)28-22(16-3-7-18(25)8-4-16)21(20)15-9-11-26-12-10-15/h1-13H,(H,27,28,29) |
| InChIKey | QWOODJDZURZLML-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
The IUPAC name of 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine (CID 11961374) is 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
The canonical SMILES for 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine is Fc1ccc(-c2nc3[nH]ncc3c(-c3ccc(F)cc3)c2-c2ccncc2)cc1.
What is the InChIKey of 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
The InChIKey is QWOODJDZURZLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14F2N4/c24-17-5-1-14(2-6-17)20-19-13-27-29-23(19)28-22(16-3-7-18(25)8-4-16)21(20)15-9-11-26-12-10-15/h1-13H,(H,27,28,29).
What are the key properties of 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine?
4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine has a molecular weight of 384.39 g/mol, XLogP of 5.63, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-bis(4-fluorophenyl)-5-pyridin-4-yl-1H-pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 11961374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).