C11H17BrClN3O — CID 119614922
N-(2-amino-1-cyclopropylethyl)-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride (PubChem CID 119614922) has the molecular formula C11H17BrClN3O and a molecular weight of 322.63 g/mol. Its IUPAC name is N-(2-amino-1-cyclopropylethyl)-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride.
| Compound Name | N-(2-amino-1-cyclopropylethyl)-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119614922 |
| Molecular Formula | C11H17BrClN3O |
| Molecular Weight | 322.63 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | N-(2-amino-1-cyclopropylethyl)-4-bromo-1-methylpyrrole-2-carboxamide;hydrochloride |
| SMILES | Cl.Cn1cc(Br)cc1C(=O)NC(CN)C1CC1 |
| InChI | InChI=1S/C11H16BrN3O.ClH/c1-15-6-8(12)4-10(15)11(16)14-9(5-13)7-2-3-7;/h4,6-7,9H,2-3,5,13H2,1H3,(H,14,16);1H |
| InChIKey | LYCUOBVKHWFTIR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.63 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |